C28H22F3NO2 — CID 10238595
N,N-dibenzyl-2-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 10238595) has the molecular formula C28H22F3NO2 and a molecular weight of 461.48 g/mol. Its IUPAC name is N,N-dibenzyl-2-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | N,N-dibenzyl-2-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 10238595 |
| Molecular Formula | C28H22F3NO2 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N,N-dibenzyl-2-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(c1ccccc1-c1ccc(OC(F)(F)F)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H22F3NO2/c29-28(30,31)34-24-17-15-23(16-18-24)25-13-7-8-14-26(25)27(33)32(19-21-9-3-1-4-10-21)20-22-11-5-2-6-12-22/h1-18H,19-20H2 |
| InChIKey | GKKUWNBAZWPCGR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |