C19H19ClF3NO4 — CID 176712199
N-benzyl-2-chloro-N-[3,3-dihydroxy-3-[4-(trifluoromethoxy)phenyl]propyl]acetamide (PubChem CID 176712199) has the molecular formula C19H19ClF3NO4 and a molecular weight of 417.81 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-[3,3-dihydroxy-3-[4-(trifluoromethoxy)phenyl]propyl]acetamide.
| Compound Name | N-benzyl-2-chloro-N-[3,3-dihydroxy-3-[4-(trifluoromethoxy)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 176712199 |
| Molecular Formula | C19H19ClF3NO4 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-benzyl-2-chloro-N-[3,3-dihydroxy-3-[4-(trifluoromethoxy)phenyl]propyl]acetamide |
| SMILES | O=C(CCl)N(CCC(O)(O)c1ccc(OC(F)(F)F)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H19ClF3NO4/c20-12-17(25)24(13-14-4-2-1-3-5-14)11-10-18(26,27)15-6-8-16(9-7-15)28-19(21,22)23/h1-9,26-27H,10-13H2 |
| InChIKey | YGKSARIVNMESCJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|