C31H26F3NO4 — CID 66774761
2-[4-[[3-phenylpropyl-[4-(trifluoromethoxy)benzoyl]amino]methyl]phenyl]benzoic acid (PubChem CID 66774761) has the molecular formula C31H26F3NO4 and a molecular weight of 533.55 g/mol. Its IUPAC name is 2-[4-[[3-phenylpropyl-[4-(trifluoromethoxy)benzoyl]amino]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[3-phenylpropyl-[4-(trifluoromethoxy)benzoyl]amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 66774761 |
| Molecular Formula | C31H26F3NO4 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 2-[4-[[3-phenylpropyl-[4-(trifluoromethoxy)benzoyl]amino]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(CN(CCCc2ccccc2)C(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H26F3NO4/c32-31(33,34)39-26-18-16-25(17-19-26)29(36)35(20-6-9-22-7-2-1-3-8-22)21-23-12-14-24(15-13-23)27-10-4-5-11-28(27)30(37)38/h1-5,7-8,10-19H,6,9,20-21H2,(H,37,38) |
| InChIKey | WJSJXIIPLGNLMQ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |