C31H28ClNO3 — CID 66775465
2-[4-[[[2-(3-chlorophenyl)acetyl]-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid (PubChem CID 66775465) has the molecular formula C31H28ClNO3 and a molecular weight of 498.02 g/mol. Its IUPAC name is 2-[4-[[[2-(3-chlorophenyl)acetyl]-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[[2-(3-chlorophenyl)acetyl]-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 66775465 |
| Molecular Formula | C31H28ClNO3 |
| Molecular Weight | 498.02 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 2-[4-[[[2-(3-chlorophenyl)acetyl]-(3-phenylpropyl)amino]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(CN(CCCc2ccccc2)C(=O)Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C31H28ClNO3/c32-27-12-6-10-25(20-27)21-30(34)33(19-7-11-23-8-2-1-3-9-23)22-24-15-17-26(18-16-24)28-13-4-5-14-29(28)31(35)36/h1-6,8-10,12-18,20H,7,11,19,21-22H2,(H,35,36) |
| InChIKey | FDLXVZNGKNCBNW-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.02 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |