C32H31NO5 — CID 66775571
2-[4-[(3,5-dimethoxyphenyl)methyl-(3-phenylpropyl)carbamoyl]phenyl]benzoic acid (PubChem CID 66775571) has the molecular formula C32H31NO5 and a molecular weight of 509.60 g/mol. Its IUPAC name is 2-[4-[(3,5-dimethoxyphenyl)methyl-(3-phenylpropyl)carbamoyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(3,5-dimethoxyphenyl)methyl-(3-phenylpropyl)carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 66775571 |
| Molecular Formula | C32H31NO5 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 2-[4-[(3,5-dimethoxyphenyl)methyl-(3-phenylpropyl)carbamoyl]phenyl]benzoic acid |
| SMILES | COc1cc(CN(CCCc2ccccc2)C(=O)c2ccc(-c3ccccc3C(=O)O)cc2)cc(OC)c1 |
| InChI | InChI=1S/C32H31NO5/c1-37-27-19-24(20-28(21-27)38-2)22-33(18-8-11-23-9-4-3-5-10-23)31(34)26-16-14-25(15-17-26)29-12-6-7-13-30(29)32(35)36/h3-7,9-10,12-17,19-21H,8,11,18,22H2,1-2H3,(H,35,36) |
| InChIKey | XPEUSLQRHKVEPS-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |