C27H29NO6 — CID 66775190
2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenoxy]acetic acid (PubChem CID 66775190) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 66775190 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[4-[[(3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(OC)cc(C(=O)N(CCCc2ccccc2)Cc2ccc(OCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C27H29NO6/c1-32-24-15-22(16-25(17-24)33-2)27(31)28(14-6-9-20-7-4-3-5-8-20)18-21-10-12-23(13-11-21)34-19-26(29)30/h3-5,7-8,10-13,15-17H,6,9,14,18-19H2,1-2H3,(H,29,30) |
| InChIKey | XRDYPWPKDWYXGF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |