C26H27NO3S — CID 66962104
2-[N-[(4-tert-butylphenyl)methyl]-4-(4-methylsulfanylphenyl)anilino]-2-oxoacetic acid (PubChem CID 66962104) has the molecular formula C26H27NO3S and a molecular weight of 433.57 g/mol. Its IUPAC name is 2-[N-[(4-tert-butylphenyl)methyl]-4-(4-methylsulfanylphenyl)anilino]-2-oxoacetic acid.
| Compound Name | 2-[N-[(4-tert-butylphenyl)methyl]-4-(4-methylsulfanylphenyl)anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 66962104 |
| Molecular Formula | C26H27NO3S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[N-[(4-tert-butylphenyl)methyl]-4-(4-methylsulfanylphenyl)anilino]-2-oxoacetic acid |
| SMILES | CSc1ccc(-c2ccc(N(Cc3ccc(C(C)(C)C)cc3)C(=O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H27NO3S/c1-26(2,3)21-11-5-18(6-12-21)17-27(24(28)25(29)30)22-13-7-19(8-14-22)20-9-15-23(31-4)16-10-20/h5-16H,17H2,1-4H3,(H,29,30) |
| InChIKey | PRUIBZGSXDISAC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|