C26H23F3O4 — CID 58007659
(E)-3-[2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid (PubChem CID 58007659) has the molecular formula C26H23F3O4 and a molecular weight of 456.46 g/mol. Its IUPAC name is (E)-3-[2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58007659 |
| Molecular Formula | C26H23F3O4 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (E)-3-[2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(-c2ccc(OC(F)(F)F)cc2)ccc1OCCCCc1ccccc1 |
| InChI | InChI=1S/C26H23F3O4/c27-26(28,29)33-23-13-9-20(10-14-23)21-11-15-24(22(18-21)12-16-25(30)31)32-17-5-4-8-19-6-2-1-3-7-19/h1-3,6-7,9-16,18H,4-5,8,17H2,(H,30,31)/b16-12+ |
| InChIKey | MHAVCXAWVIYTSU-FOWTUZBSSA-N |
| XLogP | 6.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|