C26H26O3 — CID 67444896
3-[2-[(4-tert-butylphenyl)methoxy]-5-phenylphenyl]prop-2-enoic acid (PubChem CID 67444896) has the molecular formula C26H26O3 and a molecular weight of 386.49 g/mol. Its IUPAC name is 3-[2-[(4-tert-butylphenyl)methoxy]-5-phenylphenyl]prop-2-enoic acid.
| Compound Name | 3-[2-[(4-tert-butylphenyl)methoxy]-5-phenylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67444896 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 3-[2-[(4-tert-butylphenyl)methoxy]-5-phenylphenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)c1ccc(COc2ccc(-c3ccccc3)cc2C=CC(=O)O)cc1 |
| InChI | InChI=1S/C26H26O3/c1-26(2,3)23-13-9-19(10-14-23)18-29-24-15-11-21(20-7-5-4-6-8-20)17-22(24)12-16-25(27)28/h4-17H,18H2,1-3H3,(H,27,28) |
| InChIKey | SWZPYHMTGKCFQN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|