C27H28O4 — CID 67441120
3-[2-[(4-tert-butylphenyl)methoxy]-5-(2-methoxyphenyl)phenyl]prop-2-enoic acid (PubChem CID 67441120) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[2-[(4-tert-butylphenyl)methoxy]-5-(2-methoxyphenyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-[(4-tert-butylphenyl)methoxy]-5-(2-methoxyphenyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67441120 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-[2-[(4-tert-butylphenyl)methoxy]-5-(2-methoxyphenyl)phenyl]prop-2-enoic acid |
| SMILES | COc1ccccc1-c1ccc(OCc2ccc(C(C)(C)C)cc2)c(C=CC(=O)O)c1 |
| InChI | InChI=1S/C27H28O4/c1-27(2,3)22-13-9-19(10-14-22)18-31-24-15-11-20(17-21(24)12-16-26(28)29)23-7-5-6-8-25(23)30-4/h5-17H,18H2,1-4H3,(H,28,29) |
| InChIKey | DPDDVUURHLCJCM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|