C26H20O3S — CID 21362877
(E)-3-[2-[4-(2-phenylmethoxyphenyl)thiophen-2-yl]phenyl]prop-2-enoic acid (PubChem CID 21362877) has the molecular formula C26H20O3S and a molecular weight of 412.51 g/mol. Its IUPAC name is (E)-3-[2-[4-(2-phenylmethoxyphenyl)thiophen-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[4-(2-phenylmethoxyphenyl)thiophen-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 21362877 |
| Molecular Formula | C26H20O3S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (E)-3-[2-[4-(2-phenylmethoxyphenyl)thiophen-2-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccccc1-c1cc(-c2ccccc2OCc2ccccc2)cs1 |
| InChI | InChI=1S/C26H20O3S/c27-26(28)15-14-20-10-4-5-12-23(20)25-16-21(18-30-25)22-11-6-7-13-24(22)29-17-19-8-2-1-3-9-19/h1-16,18H,17H2,(H,27,28)/b15-14+ |
| InChIKey | ZQMYSWMBIAYUIL-CCEZHUSRSA-N |
| XLogP | 6.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|