C35H38O3 — CID 67389605
3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-2-ethyl-3-methylphenyl]prop-2-enoic acid (PubChem CID 67389605) has the molecular formula C35H38O3 and a molecular weight of 506.69 g/mol. Its IUPAC name is 3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-2-ethyl-3-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-2-ethyl-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67389605 |
| Molecular Formula | C35H38O3 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-2-ethyl-3-methylphenyl]prop-2-enoic acid |
| SMILES | CCc1c(C=CC(=O)O)ccc(-c2ccc(OCc3ccccc3)c(C34CC5CC(CC(C5)C3)C4)c2)c1C |
| InChI | InChI=1S/C35H38O3/c1-3-30-23(2)31(12-9-28(30)11-14-34(36)37)29-10-13-33(38-22-24-7-5-4-6-8-24)32(18-29)35-19-25-15-26(20-35)17-27(16-25)21-35/h4-14,18,25-27H,3,15-17,19-22H2,1-2H3,(H,36,37) |
| InChIKey | GIXXHPGUBQIBED-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|