C35H37ClO4 — CID 77277166
ethyl 3-[3-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-5-chloro-2-methoxyphenyl]prop-2-enoate (PubChem CID 77277166) has the molecular formula C35H37ClO4 and a molecular weight of 557.13 g/mol. Its IUPAC name is ethyl 3-[3-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-5-chloro-2-methoxyphenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-5-chloro-2-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 77277166 |
| Molecular Formula | C35H37ClO4 |
| Molecular Weight | 557.13 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | ethyl 3-[3-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-5-chloro-2-methoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(Cl)cc(-c2ccc(OCc3ccccc3)c(C34CC5CC(CC(C5)C3)C4)c2)c1OC |
| InChI | InChI=1S/C35H37ClO4/c1-3-39-33(37)12-10-28-16-29(36)18-30(34(28)38-2)27-9-11-32(40-22-23-7-5-4-6-8-23)31(17-27)35-19-24-13-25(20-35)15-26(14-24)21-35/h4-12,16-18,24-26H,3,13-15,19-22H2,1-2H3 |
| InChIKey | FHXBXDBAMSUZLW-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.13 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|