C27H29ClO3 — CID 90798682
ethyl 3-[5-[3-(1-adamantyl)-4-hydroxyphenyl]-2-chlorophenyl]prop-2-enoate (PubChem CID 90798682) has the molecular formula C27H29ClO3 and a molecular weight of 436.98 g/mol. Its IUPAC name is ethyl 3-[5-[3-(1-adamantyl)-4-hydroxyphenyl]-2-chlorophenyl]prop-2-enoate.
| Compound Name | ethyl 3-[5-[3-(1-adamantyl)-4-hydroxyphenyl]-2-chlorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90798682 |
| Molecular Formula | C27H29ClO3 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | ethyl 3-[5-[3-(1-adamantyl)-4-hydroxyphenyl]-2-chlorophenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(-c2ccc(O)c(C34CC5CC(CC(C5)C3)C4)c2)ccc1Cl |
| InChI | InChI=1S/C27H29ClO3/c1-2-31-26(30)8-5-22-12-20(3-6-24(22)28)21-4-7-25(29)23(13-21)27-14-17-9-18(15-27)11-19(10-17)16-27/h3-8,12-13,17-19,29H,2,9-11,14-16H2,1H3 |
| InChIKey | FXMKBWQZBBFCIO-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|