C27H28Cl2O3 — CID 87382209
ethyl (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3,5-dichlorophenyl]prop-2-enoate (PubChem CID 87382209) has the molecular formula C27H28Cl2O3 and a molecular weight of 471.42 g/mol. Its IUPAC name is ethyl (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3,5-dichlorophenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3,5-dichlorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 87382209 |
| Molecular Formula | C27H28Cl2O3 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | ethyl (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3,5-dichlorophenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(Cl)c(-c2ccc(O)c(C34CC5CC(CC(C5)C3)C4)c2)c(Cl)c1 |
| InChI | InChI=1S/C27H28Cl2O3/c1-2-32-25(31)6-3-16-10-22(28)26(23(29)11-16)20-4-5-24(30)21(12-20)27-13-17-7-18(14-27)9-19(8-17)15-27/h3-6,10-12,17-19,30H,2,7-9,13-15H2,1H3/b6-3+ |
| InChIKey | LZIAFOZXIBUPMB-ZZXKWVIFSA-N |
| XLogP | 7.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|