C36H39ClO4 — CID 77277185
ethyl 3-[3-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-5-chloro-2-ethoxyphenyl]prop-2-enoate (PubChem CID 77277185) has the molecular formula C36H39ClO4 and a molecular weight of 571.16 g/mol. Its IUPAC name is ethyl 3-[3-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-5-chloro-2-ethoxyphenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-5-chloro-2-ethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 77277185 |
| Molecular Formula | C36H39ClO4 |
| Molecular Weight | 571.16 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | ethyl 3-[3-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-5-chloro-2-ethoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(Cl)cc(-c2ccc(OCc3ccccc3)c(C34CC5CC(CC(C5)C3)C4)c2)c1OCC |
| InChI | InChI=1S/C36H39ClO4/c1-3-39-34(38)13-11-29-17-30(37)19-31(35(29)40-4-2)28-10-12-33(41-23-24-8-6-5-7-9-24)32(18-28)36-20-25-14-26(21-36)16-27(15-25)22-36/h5-13,17-19,25-27H,3-4,14-16,20-23H2,1-2H3 |
| InChIKey | SLCLQHQFRCLTOL-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.16 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|