C32H31ClO3 — CID 22134784
(E)-3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-3-chlorophenyl]prop-2-enoic acid (PubChem CID 22134784) has the molecular formula C32H31ClO3 and a molecular weight of 499.05 g/mol. Its IUPAC name is (E)-3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-3-chlorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-3-chlorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22134784 |
| Molecular Formula | C32H31ClO3 |
| Molecular Weight | 499.05 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (E)-3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-3-chlorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2ccc(OCc3ccccc3)c(C34CC5CC(CC(C5)C3)C4)c2)c(Cl)c1 |
| InChI | InChI=1S/C32H31ClO3/c33-29-15-21(7-11-31(34)35)6-9-27(29)26-8-10-30(36-20-22-4-2-1-3-5-22)28(16-26)32-17-23-12-24(18-32)14-25(13-23)19-32/h1-11,15-16,23-25H,12-14,17-20H2,(H,34,35)/b11-7+ |
| InChIKey | AZFHOZCNLZFFHR-YRNVUSSQSA-N |
| XLogP | 8.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.05 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|