C27H28ClNO3 — CID 25023777
(E)-3-[4-[4-acetamido-3-(1-adamantyl)phenyl]-3-chlorophenyl]prop-2-enoic acid (PubChem CID 25023777) has the molecular formula C27H28ClNO3 and a molecular weight of 449.98 g/mol. Its IUPAC name is (E)-3-[4-[4-acetamido-3-(1-adamantyl)phenyl]-3-chlorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-acetamido-3-(1-adamantyl)phenyl]-3-chlorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 25023777 |
| Molecular Formula | C27H28ClNO3 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (E)-3-[4-[4-acetamido-3-(1-adamantyl)phenyl]-3-chlorophenyl]prop-2-enoic acid |
| SMILES | CC(=O)Nc1ccc(-c2ccc(/C=C/C(=O)O)cc2Cl)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H28ClNO3/c1-16(30)29-25-6-4-21(22-5-2-17(11-24(22)28)3-7-26(31)32)12-23(25)27-13-18-8-19(14-27)10-20(9-18)15-27/h2-7,11-12,18-20H,8-10,13-15H2,1H3,(H,29,30)(H,31,32)/b7-3+ |
| InChIKey | WAHJESODRLFYLI-XVNBXDOJSA-N |
| XLogP | 6.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|