C25H25ClO3 — CID 74064216
3-[4-[5-(1-adamantyl)-2-chloro-4-hydroxyphenyl]phenyl]prop-2-enoic acid (PubChem CID 74064216) has the molecular formula C25H25ClO3 and a molecular weight of 408.93 g/mol. Its IUPAC name is 3-[4-[5-(1-adamantyl)-2-chloro-4-hydroxyphenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[5-(1-adamantyl)-2-chloro-4-hydroxyphenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 74064216 |
| Molecular Formula | C25H25ClO3 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 3-[4-[5-(1-adamantyl)-2-chloro-4-hydroxyphenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(-c2cc(C34CC5CC(CC(C5)C3)C4)c(O)cc2Cl)cc1 |
| InChI | InChI=1S/C25H25ClO3/c26-22-11-23(27)21(25-12-16-7-17(13-25)9-18(8-16)14-25)10-20(22)19-4-1-15(2-5-19)3-6-24(28)29/h1-6,10-11,16-18,27H,7-9,12-14H2,(H,28,29) |
| InChIKey | FSZNFILHAWMKCB-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|