C26H26O4 — CID 10179244
(E)-3-[4-[7-(1-adamantyl)-1,3-benzodioxol-5-yl]phenyl]prop-2-enoic acid (PubChem CID 10179244) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is (E)-3-[4-[7-(1-adamantyl)-1,3-benzodioxol-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[7-(1-adamantyl)-1,3-benzodioxol-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10179244 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (E)-3-[4-[7-(1-adamantyl)-1,3-benzodioxol-5-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2cc3c(c(C45CC6CC(CC(C6)C4)C5)c2)OCO3)cc1 |
| InChI | InChI=1S/C26H26O4/c27-24(28)6-3-16-1-4-20(5-2-16)21-10-22(25-23(11-21)29-15-30-25)26-12-17-7-18(13-26)9-19(8-17)14-26/h1-6,10-11,17-19H,7-9,12-15H2,(H,27,28)/b6-3+ |
| InChIKey | YBGNRVCYLCJHHA-ZZXKWVIFSA-N |
| XLogP | 5.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|