C31H40O3Si — CID 90907725
3-[4-[3-(1-adamantyl)-4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]prop-2-enoic acid (PubChem CID 90907725) has the molecular formula C31H40O3Si and a molecular weight of 488.74 g/mol. Its IUPAC name is 3-[4-[3-(1-adamantyl)-4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[3-(1-adamantyl)-4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90907725 |
| Molecular Formula | C31H40O3Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 3-[4-[3-(1-adamantyl)-4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2ccc(C=CC(=O)O)cc2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H40O3Si/c1-30(2,3)35(4,5)34-28-12-11-26(25-9-6-21(7-10-25)8-13-29(32)33)17-27(28)31-18-22-14-23(19-31)16-24(15-22)20-31/h6-13,17,22-24H,14-16,18-20H2,1-5H3,(H,32,33) |
| InChIKey | JMSIZSPHFSJYGJ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|