C32H39NO3SSi — CID 87899054
(5Z)-5-[[2-[3-(1-adamantyl)-4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87899054) has the molecular formula C32H39NO3SSi and a molecular weight of 545.82 g/mol. Its IUPAC name is (5Z)-5-[[2-[3-(1-adamantyl)-4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[3-(1-adamantyl)-4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87899054 |
| Molecular Formula | C32H39NO3SSi |
| Molecular Weight | 545.82 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (5Z)-5-[[2-[3-(1-adamantyl)-4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2ccccc2/C=C2\SC(=O)NC2=O)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H39NO3SSi/c1-31(2,3)38(4,5)36-27-11-10-24(15-26(27)32-17-20-12-21(18-32)14-22(13-20)19-32)25-9-7-6-8-23(25)16-28-29(34)33-30(35)37-28/h6-11,15-16,20-22H,12-14,17-19H2,1-5H3,(H,33,34,35)/b28-16- |
| InChIKey | MAYXWUVMLYKKLD-NTFVMDSBSA-N |
| XLogP | 8.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.82 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|