C10H6INO2S — CID 2243788
(5E)-5-[(2-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2243788) has the molecular formula C10H6INO2S and a molecular weight of 331.13 g/mol. Its IUPAC name is (5E)-5-[(2-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2243788 |
| Molecular Formula | C10H6INO2S |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | (5E)-5-[(2-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccccc2I)S1 |
| InChI | InChI=1S/C10H6INO2S/c11-7-4-2-1-3-6(7)5-8-9(13)12-10(14)15-8/h1-5H,(H,12,13,14)/b8-5+ |
| InChIKey | LPHYTWZUFKIWES-VMPITWQZSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|