C12H7NO2S2 — CID 156538731
(5Z)-5-(1-benzothiophen-3-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 156538731) has the molecular formula C12H7NO2S2 and a molecular weight of 261.33 g/mol. Its IUPAC name is (5Z)-5-(1-benzothiophen-3-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-(1-benzothiophen-3-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 156538731 |
| Molecular Formula | C12H7NO2S2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | (5Z)-5-(1-benzothiophen-3-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2csc3ccccc23)S1 |
| InChI | InChI=1S/C12H7NO2S2/c14-11-10(17-12(15)13-11)5-7-6-16-9-4-2-1-3-8(7)9/h1-6H,(H,13,14,15)/b10-5- |
| InChIKey | ZVRDAOGQPIPDDD-YHYXMXQVSA-N |
| XLogP | 3.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|