C26H24FNO3S — CID 58765653
(5Z)-5-[[4-[3-(1-adamantyl)-5-fluoro-4-hydroxyphenyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58765653) has the molecular formula C26H24FNO3S and a molecular weight of 449.55 g/mol. Its IUPAC name is (5Z)-5-[[4-[3-(1-adamantyl)-5-fluoro-4-hydroxyphenyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[3-(1-adamantyl)-5-fluoro-4-hydroxyphenyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58765653 |
| Molecular Formula | C26H24FNO3S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (5Z)-5-[[4-[3-(1-adamantyl)-5-fluoro-4-hydroxyphenyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(-c3cc(F)c(O)c(C45CC6CC(CC(C6)C4)C5)c3)cc2)S1 |
| InChI | InChI=1S/C26H24FNO3S/c27-21-10-19(18-3-1-14(2-4-18)8-22-24(30)28-25(31)32-22)9-20(23(21)29)26-11-15-5-16(12-26)7-17(6-15)13-26/h1-4,8-10,15-17,29H,5-7,11-13H2,(H,28,30,31)/b22-8- |
| InChIKey | DEPMATVNMYAXHP-UYOCIXKTSA-N |
| XLogP | 5.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|