C25H26FNO3S — CID 87843043
(5E)-5-[[3-fluoro-4-hydroxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87843043) has the molecular formula C25H26FNO3S and a molecular weight of 439.55 g/mol. Its IUPAC name is (5E)-5-[[3-fluoro-4-hydroxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-fluoro-4-hydroxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87843043 |
| Molecular Formula | C25H26FNO3S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (5E)-5-[[3-fluoro-4-hydroxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc2c(cc1-c1cc(/C=C3/SC(=O)NC3=O)cc(F)c1O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H26FNO3S/c1-13-8-17-18(25(4,5)7-6-24(17,2)3)12-15(13)16-9-14(10-19(26)21(16)28)11-20-22(29)27-23(30)31-20/h8-12,28H,6-7H2,1-5H3,(H,27,29,30)/b20-11+ |
| InChIKey | VHZCWMZMEXWHCB-RGVLZGJSSA-N |
| XLogP | 6.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|