C27H31NO2S — CID 10296563
(5Z)-5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10296563) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10296563 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (5Z)-5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(C)(C)c3ccc(/C=C4\SC(=O)NC4=O)cc3)ccc21 |
| InChI | InChI=1S/C27H31NO2S/c1-25(2)13-14-26(3,4)21-16-19(11-12-20(21)25)27(5,6)18-9-7-17(8-10-18)15-22-23(29)28-24(30)31-22/h7-12,15-16H,13-14H2,1-6H3,(H,28,29,30)/b22-15- |
| InChIKey | INTRMXIEXPQFDG-JCMHNJIXSA-N |
| XLogP | 6.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|