C27H31NOS2 — CID 91481570
2-sulfanylidene-5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 91481570) has the molecular formula C27H31NOS2 and a molecular weight of 449.69 g/mol. Its IUPAC name is 2-sulfanylidene-5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-sulfanylidene-5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 91481570 |
| Molecular Formula | C27H31NOS2 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-sulfanylidene-5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(C)(C)c3ccc(C=C4SC(=S)NC4=O)cc3)ccc21 |
| InChI | InChI=1S/C27H31NOS2/c1-25(2)13-14-26(3,4)21-16-19(11-12-20(21)25)27(5,6)18-9-7-17(8-10-18)15-22-23(29)28-24(30)31-22/h7-12,15-16H,13-14H2,1-6H3,(H,28,29,30) |
| InChIKey | NNGQHUIMLBIJTD-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|