C20H14N2O2S4 — CID 139059666
(5Z)-5-benzylidene-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 139059666) has the molecular formula C20H14N2O2S4 and a molecular weight of 442.61 g/mol. Its IUPAC name is (5Z)-5-benzylidene-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-benzylidene-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 139059666 |
| Molecular Formula | C20H14N2O2S4 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | (5Z)-5-benzylidene-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1ccccc1.O=C1NC(=S)S/C1=C\c1ccccc1 |
| InChI | InChI=1S/2C10H7NOS2/c2*12-9-8(14-10(13)11-9)6-7-4-2-1-3-5-7/h2*1-6H,(H,11,12,13)/b2*8-6- |
| InChIKey | COAKMKNXACGOIZ-HFSICSMJSA-N |
| XLogP | 4.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|