C11H8N2O2S2 — CID 142041140
4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide (PubChem CID 142041140) has the molecular formula C11H8N2O2S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide.
| Compound Name | 4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 142041140 |
| Molecular Formula | C11H8N2O2S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide |
| SMILES | NC(=O)c1ccc(/C=C2\SC(=S)NC2=O)cc1 |
| InChI | InChI=1S/C11H8N2O2S2/c12-9(14)7-3-1-6(2-4-7)5-8-10(15)13-11(16)17-8/h1-5H,(H2,12,14)(H,13,15,16)/b8-5- |
| InChIKey | BKLSDVLKRXZBGG-YVMONPNESA-N |
| XLogP | 1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|