C26H23F6NO3S — CID 85071073
5-[[3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 85071073) has the molecular formula C26H23F6NO3S and a molecular weight of 543.53 g/mol. Its IUPAC name is 5-[[3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 85071073 |
| Molecular Formula | C26H23F6NO3S |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 5-[[3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(F)(F)F)c(-c3cc(C=C4SC(=O)NC4=O)ccc3OC(F)(F)F)cc21 |
| InChI | InChI=1S/C26H23F6NO3S/c1-23(2)7-8-24(3,4)18-12-16(25(27,28)29)14(11-17(18)23)15-9-13(5-6-19(15)36-26(30,31)32)10-20-21(34)33-22(35)37-20/h5-6,9-12H,7-8H2,1-4H3,(H,33,34,35) |
| InChIKey | CZSBIXAYWPGICH-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|