C28H22F3NO4S — CID 72614970
5-[[3-[8-(furan-2-yl)-3,5,5-trimethyl-6H-naphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 72614970) has the molecular formula C28H22F3NO4S and a molecular weight of 525.55 g/mol. Its IUPAC name is 5-[[3-[8-(furan-2-yl)-3,5,5-trimethyl-6H-naphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[8-(furan-2-yl)-3,5,5-trimethyl-6H-naphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 72614970 |
| Molecular Formula | C28H22F3NO4S |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 5-[[3-[8-(furan-2-yl)-3,5,5-trimethyl-6H-naphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc2c(cc1-c1cc(C=C3SC(=O)NC3=O)ccc1OC(F)(F)F)C(c1ccco1)=CCC2(C)C |
| InChI | InChI=1S/C28H22F3NO4S/c1-15-11-21-19(17(8-9-27(21,2)3)22-5-4-10-35-22)14-18(15)20-12-16(6-7-23(20)36-28(29,30)31)13-24-25(33)32-26(34)37-24/h4-8,10-14H,9H2,1-3H3,(H,32,33,34) |
| InChIKey | PNEVXHIBZXMELJ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|