C24H22F3NO6S — CID 10152437
(5E)-5-[[3-[5-(2-hydroxyethoxymethyl)-3,3-dimethyl-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10152437) has the molecular formula C24H22F3NO6S and a molecular weight of 509.50 g/mol. Its IUPAC name is (5E)-5-[[3-[5-(2-hydroxyethoxymethyl)-3,3-dimethyl-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-[5-(2-hydroxyethoxymethyl)-3,3-dimethyl-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10152437 |
| Molecular Formula | C24H22F3NO6S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | (5E)-5-[[3-[5-(2-hydroxyethoxymethyl)-3,3-dimethyl-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(C)COc2c(-c3cc(/C=C4/SC(=O)NC4=O)ccc3OC(F)(F)F)cc(COCCO)cc21 |
| InChI | InChI=1S/C24H22F3NO6S/c1-23(2)12-33-20-16(8-14(9-17(20)23)11-32-6-5-29)15-7-13(3-4-18(15)34-24(25,26)27)10-19-21(30)28-22(31)35-19/h3-4,7-10,29H,5-6,11-12H2,1-2H3,(H,28,30,31)/b19-10+ |
| InChIKey | HALNEDDTDLVQAO-VXLYETTFSA-N |
| XLogP | 4.76 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|