C27H28F2N2O3S — CID 142245145
7-[2-(1,1-difluoroethoxy)-5-[(Z)-(2,4-dimethylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-N,N,3,3-tetramethyl-2H-1-benzofuran-5-carboxamide (PubChem CID 142245145) has the molecular formula C27H28F2N2O3S and a molecular weight of 498.60 g/mol. Its IUPAC name is 7-[2-(1,1-difluoroethoxy)-5-[(Z)-(2,4-dimethylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-N,N,3,3-tetramethyl-2H-1-benzofuran-5-carboxamide.
| Compound Name | 7-[2-(1,1-difluoroethoxy)-5-[(Z)-(2,4-dimethylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-N,N,3,3-tetramethyl-2H-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 142245145 |
| Molecular Formula | C27H28F2N2O3S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 7-[2-(1,1-difluoroethoxy)-5-[(Z)-(2,4-dimethylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]-N,N,3,3-tetramethyl-2H-1-benzofuran-5-carboxamide |
| SMILES | C=C1NC(=C)/C(=C/c2ccc(OC(C)(F)F)c(-c3cc(C(=O)N(C)C)cc4c3OCC4(C)C)c2)S1 |
| InChI | InChI=1S/C27H28F2N2O3S/c1-15-23(35-16(2)30-15)11-17-8-9-22(34-27(5,28)29)19(10-17)20-12-18(25(32)31(6)7)13-21-24(20)33-14-26(21,3)4/h8-13,30H,1-2,14H2,3-7H3/b23-11- |
| InChIKey | WQMRKNPMDVXMKC-KSEXSDGBSA-N |
| XLogP | 6.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |