C23H18F3NO6S — CID 58824803
methyl 7-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-(trifluoromethoxy)phenyl]-3,3-dimethyl-2H-1-benzofuran-5-carboxylate (PubChem CID 58824803) has the molecular formula C23H18F3NO6S and a molecular weight of 493.46 g/mol. Its IUPAC name is methyl 7-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-(trifluoromethoxy)phenyl]-3,3-dimethyl-2H-1-benzofuran-5-carboxylate.
| Compound Name | methyl 7-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-(trifluoromethoxy)phenyl]-3,3-dimethyl-2H-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 58824803 |
| Molecular Formula | C23H18F3NO6S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | methyl 7-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-(trifluoromethoxy)phenyl]-3,3-dimethyl-2H-1-benzofuran-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2cc(/C=C3\SC(=O)NC3=O)ccc2OC(F)(F)F)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C23H18F3NO6S/c1-22(2)10-32-18-14(8-12(9-15(18)22)20(29)31-3)13-6-11(4-5-16(13)33-23(24,25)26)7-17-19(28)27-21(30)34-17/h4-9H,10H2,1-3H3,(H,27,28,30)/b17-7- |
| InChIKey | UCFNUNDTGDWNKC-IDUWFGFVSA-N |
| XLogP | 5.03 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|