C25H23F3N2O4S — CID 85075591
5-[[3-(8-methoxyimino-3,5,5-trimethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 85075591) has the molecular formula C25H23F3N2O4S and a molecular weight of 504.53 g/mol. Its IUPAC name is 5-[[3-(8-methoxyimino-3,5,5-trimethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-(8-methoxyimino-3,5,5-trimethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 85075591 |
| Molecular Formula | C25H23F3N2O4S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 5-[[3-(8-methoxyimino-3,5,5-trimethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CON=C1CCC(C)(C)c2cc(C)c(-c3cc(C=C4SC(=O)NC4=O)ccc3OC(F)(F)F)cc21 |
| InChI | InChI=1S/C25H23F3N2O4S/c1-13-9-18-17(19(30-33-4)7-8-24(18,2)3)12-15(13)16-10-14(5-6-20(16)34-25(26,27)28)11-21-22(31)29-23(32)35-21/h5-6,9-12H,7-8H2,1-4H3,(H,29,31,32) |
| InChIKey | OVPHBMHPGSMCMM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|