C27H31NO2S — CID 23560011
(5Z)-5-[[3-(3-ethyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-methylphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 23560011) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is (5Z)-5-[[3-(3-ethyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-methylphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-(3-ethyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-methylphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 23560011 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (5Z)-5-[[3-(3-ethyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-4-methylphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1cc2c(cc1-c1cc(/C=C3\SC(=O)NC3=O)ccc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H31NO2S/c1-7-18-14-21-22(27(5,6)11-10-26(21,3)4)15-20(18)19-12-17(9-8-16(19)2)13-23-24(29)28-25(30)31-23/h8-9,12-15H,7,10-11H2,1-6H3,(H,28,29,30)/b23-13- |
| InChIKey | AYKANSZSVQCLKJ-QRVIBDJDSA-N |
| XLogP | 6.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|