C26H29N3O3S — CID 87888446
5-[[4-(ethylamino)-3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87888446) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 5-[[4-(ethylamino)-3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(ethylamino)-3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87888446 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 5-[[4-(ethylamino)-3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCNc1ccc(C=C2SC(=O)NC2=O)cc1-c1cc2c(cc1C)C(C)(C)CC(=O)N2CC |
| InChI | InChI=1S/C26H29N3O3S/c1-6-27-20-9-8-16(12-22-24(31)28-25(32)33-22)11-18(20)17-13-21-19(10-15(17)3)26(4,5)14-23(30)29(21)7-2/h8-13,27H,6-7,14H2,1-5H3,(H,28,31,32) |
| InChIKey | FQHFXXCZTRYANX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|