C26H29N3O3S — CID 87891091
(5E)-5-[[4-(dimethylamino)-3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87891091) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is (5E)-5-[[4-(dimethylamino)-3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(dimethylamino)-3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87891091 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (5E)-5-[[4-(dimethylamino)-3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1C(=O)CC(C)(C)c2cc(C)c(-c3cc(/C=C4/SC(=O)NC4=O)ccc3N(C)C)cc21 |
| InChI | InChI=1S/C26H29N3O3S/c1-7-29-21-13-17(15(2)10-19(21)26(3,4)14-23(29)30)18-11-16(8-9-20(18)28(5)6)12-22-24(31)27-25(32)33-22/h8-13H,7,14H2,1-6H3,(H,27,31,32)/b22-12+ |
| InChIKey | NBTOFQXOPMRLOR-WSDLNYQXSA-N |
| XLogP | 5.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|