C26H31NO4 — CID 68666786
ethyl (E)-3-[3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)-4-methoxyphenyl]prop-2-enoate (PubChem CID 68666786) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl (E)-3-[3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)-4-methoxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68666786 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | ethyl (E)-3-[3-(1-ethyl-4,4,6-trimethyl-2-oxo-3H-quinolin-7-yl)-4-methoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OC)c(-c2cc3c(cc2C)C(C)(C)CC(=O)N3CC)c1 |
| InChI | InChI=1S/C26H31NO4/c1-7-27-22-15-19(17(3)13-21(22)26(4,5)16-24(27)28)20-14-18(9-11-23(20)30-6)10-12-25(29)31-8-2/h9-15H,7-8,16H2,1-6H3/b12-10+ |
| InChIKey | HWEWVHKXJQJCJY-ZRDIBKRKSA-N |
| XLogP | 5.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|