C13H11NO4 — CID 169480926
ethyl 3-(1,3-dioxoisoindol-5-yl)prop-2-enoate (PubChem CID 169480926) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is ethyl 3-(1,3-dioxoisoindol-5-yl)prop-2-enoate.
| Compound Name | ethyl 3-(1,3-dioxoisoindol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 169480926 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | ethyl 3-(1,3-dioxoisoindol-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C13H11NO4/c1-2-18-11(15)6-4-8-3-5-9-10(7-8)13(17)14-12(9)16/h3-7H,2H2,1H3,(H,14,16,17) |
| InChIKey | FNGRVLRWDSGUIG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|