C13H12N2O3 — CID 169466209
N-[3-(1,3-dioxoisoindol-5-yl)prop-2-enyl]acetamide (PubChem CID 169466209) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-5-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-5-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169466209 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-5-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C13H12N2O3/c1-8(16)14-6-2-3-9-4-5-10-11(7-9)13(18)15-12(10)17/h2-5,7H,6H2,1H3,(H,14,16)(H,15,17,18) |
| InChIKey | ROFGYSAFFHAZJR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|