C19H17FO2 — CID 54234505
ethyl 3-(7-fluoro-9,10-dihydrophenanthren-2-yl)prop-2-enoate (PubChem CID 54234505) has the molecular formula C19H17FO2 and a molecular weight of 296.34 g/mol. Its IUPAC name is ethyl 3-(7-fluoro-9,10-dihydrophenanthren-2-yl)prop-2-enoate.
| Compound Name | ethyl 3-(7-fluoro-9,10-dihydrophenanthren-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 54234505 |
| Molecular Formula | C19H17FO2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | ethyl 3-(7-fluoro-9,10-dihydrophenanthren-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc2c(c1)CCc1cc(F)ccc1-2 |
| InChI | InChI=1S/C19H17FO2/c1-2-22-19(21)10-4-13-3-8-17-14(11-13)5-6-15-12-16(20)7-9-18(15)17/h3-4,7-12H,2,5-6H2,1H3 |
| InChIKey | QLPAEYKTJCJPCH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|