C15H20ClNO2 — CID 67782323
ethyl 3-[(7S)-7-amino-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate;hydrochloride (PubChem CID 67782323) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is ethyl 3-[(7S)-7-amino-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate;hydrochloride.
| Compound Name | ethyl 3-[(7S)-7-amino-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 67782323 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethyl 3-[(7S)-7-amino-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate;hydrochloride |
| SMILES | CCOC(=O)C=Cc1ccc2c(c1)C[C@@H](N)CC2.Cl |
| InChI | InChI=1S/C15H19NO2.ClH/c1-2-18-15(17)8-4-11-3-5-12-6-7-14(16)10-13(12)9-11;/h3-5,8-9,14H,2,6-7,10,16H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | WVYBVASNZWKVAX-UQKRIMTDSA-N |
| XLogP | 2.50 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|