C24H28ClNO3 — CID 54414859
ethyl 3-[7-[[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate (PubChem CID 54414859) has the molecular formula C24H28ClNO3 and a molecular weight of 413.95 g/mol. Its IUPAC name is ethyl 3-[7-[[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate.
| Compound Name | ethyl 3-[7-[[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 54414859 |
| Molecular Formula | C24H28ClNO3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | ethyl 3-[7-[[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc2c(c1)CC(CNCC(O)c1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C24H28ClNO3/c1-2-29-24(28)11-8-17-6-9-19-10-7-18(13-21(19)12-17)15-26-16-23(27)20-4-3-5-22(25)14-20/h3-6,8-9,11-12,14,18,23,26-27H,2,7,10,13,15-16H2,1H3 |
| InChIKey | VWROTIFHEBXSFU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|