C23H20F3NO5S — CID 10217449
(5E)-5-[[3-[5-(methoxymethyl)-3,3-dimethyl-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10217449) has the molecular formula C23H20F3NO5S and a molecular weight of 479.48 g/mol. Its IUPAC name is (5E)-5-[[3-[5-(methoxymethyl)-3,3-dimethyl-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-[5-(methoxymethyl)-3,3-dimethyl-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10217449 |
| Molecular Formula | C23H20F3NO5S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | (5E)-5-[[3-[5-(methoxymethyl)-3,3-dimethyl-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COCc1cc(-c2cc(/C=C3/SC(=O)NC3=O)ccc2OC(F)(F)F)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C23H20F3NO5S/c1-22(2)11-31-19-15(7-13(10-30-3)8-16(19)22)14-6-12(4-5-17(14)32-23(24,25)26)9-18-20(28)27-21(29)33-18/h4-9H,10-11H2,1-3H3,(H,27,28,29)/b18-9+ |
| InChIKey | BUCSWOOTHTYFNE-GIJQJNRQSA-N |
| XLogP | 5.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|