C23H23F6NO2 — CID 59065280
(NE)-N-[[3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]hydroxylamine (PubChem CID 59065280) has the molecular formula C23H23F6NO2 and a molecular weight of 459.43 g/mol. Its IUPAC name is (NE)-N-[[3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 59065280 |
| Molecular Formula | C23H23F6NO2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (NE)-N-[[3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]-4-(trifluoromethoxy)phenyl]methylidene]hydroxylamine |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(F)(F)F)c(-c3cc(/C=N/O)ccc3OC(F)(F)F)cc21 |
| InChI | InChI=1S/C23H23F6NO2/c1-20(2)7-8-21(3,4)18-11-16(22(24,25)26)14(10-17(18)20)15-9-13(12-30-31)5-6-19(15)32-23(27,28)29/h5-6,9-12,31H,7-8H2,1-4H3/b30-12+ |
| InChIKey | FKETZOZWYYVTQG-PNQUVVCRSA-N |
| XLogP | 7.43 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|