C25H25F2NO2S2 — CID 23559985
(5Z)-5-[[2,5-difluoro-4-hydroxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 23559985) has the molecular formula C25H25F2NO2S2 and a molecular weight of 473.61 g/mol. Its IUPAC name is (5Z)-5-[[2,5-difluoro-4-hydroxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2,5-difluoro-4-hydroxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23559985 |
| Molecular Formula | C25H25F2NO2S2 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (5Z)-5-[[2,5-difluoro-4-hydroxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cc2c(cc1-c1c(O)c(F)cc(/C=C3\SC(=S)NC3=O)c1F)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H25F2NO2S2/c1-12-8-15-16(25(4,5)7-6-24(15,2)3)11-14(12)19-20(27)13(9-17(26)21(19)29)10-18-22(30)28-23(31)32-18/h8-11,29H,6-7H2,1-5H3,(H,28,30,31)/b18-10- |
| InChIKey | RYRBNOHUHJRPEM-ZDLGFXPLSA-N |
| XLogP | 6.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|