C26H25F2NO3S — CID 59987626
(5Z)-5-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 59987626) has the molecular formula C26H25F2NO3S and a molecular weight of 469.55 g/mol. Its IUPAC name is (5Z)-5-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59987626 |
| Molecular Formula | C26H25F2NO3S |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (5Z)-5-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1c(F)cc(/C=C2\SC(=O)NC2=O)c(F)c1-c1cc2c(cc1C)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C26H25F2NO3S/c1-13-9-16-17(26(4,5)8-7-25(16,2)3)12-15(13)20-21(28)14(10-18(27)22(20)32-6)11-19-23(30)29-24(31)33-19/h7-12H,1-6H3,(H,29,30,31)/b19-11- |
| InChIKey | JBYLJPSNHYHVDS-ODLFYWEKSA-N |
| XLogP | 6.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|