C26H30F2N2O3 — CID 91512296
4-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-5-hydroxy-1,3-dihydroimidazol-2-one (PubChem CID 91512296) has the molecular formula C26H30F2N2O3 and a molecular weight of 456.53 g/mol. Its IUPAC name is 4-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-5-hydroxy-1,3-dihydroimidazol-2-one.
| Compound Name | 4-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-5-hydroxy-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 91512296 |
| Molecular Formula | C26H30F2N2O3 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 4-[[2,5-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-5-hydroxy-1,3-dihydroimidazol-2-one |
| SMILES | COc1c(F)cc(Cc2[nH]c(=O)[nH]c2O)c(F)c1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H30F2N2O3/c1-13-9-16-17(26(4,5)8-7-25(16,2)3)12-15(13)20-21(28)14(10-18(27)22(20)33-6)11-19-23(31)30-24(32)29-19/h9-10,12,31H,7-8,11H2,1-6H3,(H2,29,30,32) |
| InChIKey | PBHGTYNRXMTQOL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |